C17H22N4O5S2 — CID 108846773
2-[[(Z)-2-cyano-3-[2-(4-sulfamoylphenyl)ethylamino]prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 108846773) has the molecular formula C17H22N4O5S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-[[(Z)-2-cyano-3-[2-(4-sulfamoylphenyl)ethylamino]prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[(Z)-2-cyano-3-[2-(4-sulfamoylphenyl)ethylamino]prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 108846773 |
| Molecular Formula | C17H22N4O5S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 2-[[(Z)-2-cyano-3-[2-(4-sulfamoylphenyl)ethylamino]prop-2-enoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)/C(C#N)=C\NCCc1ccc(S(N)(=O)=O)cc1)C(=O)O |
| InChI | InChI=1S/C17H22N4O5S2/c1-27-9-7-15(17(23)24)21-16(22)13(10-18)11-20-8-6-12-2-4-14(5-3-12)28(19,25)26/h2-5,11,15,20H,6-9H2,1H3,(H,21,22)(H,23,24)(H2,19,25,26)/b13-11- |
| InChIKey | IAJWBVQHUVFEDT-QBFSEMIESA-N |
| XLogP | 0.20 |
| TPSA | 162.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|