C24H32N4O2 — CID 108848022
(Z)-2-cyano-3-[3-(2-oxopyrrolidin-1-yl)propylamino]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]prop-2-enamide (PubChem CID 108848022) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-(2-oxopyrrolidin-1-yl)propylamino]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3-(2-oxopyrrolidin-1-yl)propylamino]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 108848022 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | (Z)-2-cyano-3-[3-(2-oxopyrrolidin-1-yl)propylamino]-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)propyl]prop-2-enamide |
| SMILES | CCC(NC(=O)/C(C#N)=C\NCCCN1CCCC1=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C24H32N4O2/c1-2-22(20-11-10-18-7-3-4-8-19(18)15-20)27-24(30)21(16-25)17-26-12-6-14-28-13-5-9-23(28)29/h10-11,15,17,22,26H,2-9,12-14H2,1H3,(H,27,30)/b21-17- |
| InChIKey | HQFLASMNZQXNMC-FXBPSFAMSA-N |
| XLogP | 3.14 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|