C27H42O8 — CID 10885530
methyl (3E,5S,7R,8R,9E,11E)-7-(2,2-dimethylpropanoyloxymethyl)-5-hydroxy-8-(methoxymethoxy)-3,13,13-trimethyl-14-oxocyclotetradeca-3,9,11-triene-1-carboxylate (PubChem CID 10885530) has the molecular formula C27H42O8 and a molecular weight of 494.63 g/mol. Its IUPAC name is methyl (3E,5S,7R,8R,9E,11E)-7-(2,2-dimethylpropanoyloxymethyl)-5-hydroxy-8-(methoxymethoxy)-3,13,13-trimethyl-14-oxocyclotetradeca-3,9,11-triene-1-carboxylate.
| Compound Name | methyl (3E,5S,7R,8R,9E,11E)-7-(2,2-dimethylpropanoyloxymethyl)-5-hydroxy-8-(methoxymethoxy)-3,13,13-trimethyl-14-oxocyclotetradeca-3,9,11-triene-1-carboxylate |
|---|---|
| PubChem CID | 10885530 |
| Molecular Formula | C27H42O8 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | methyl (3E,5S,7R,8R,9E,11E)-7-(2,2-dimethylpropanoyloxymethyl)-5-hydroxy-8-(methoxymethoxy)-3,13,13-trimethyl-14-oxocyclotetradeca-3,9,11-triene-1-carboxylate |
| SMILES | COCO[C@@H]1/C=C/C=C/C(C)(C)C(=O)C(C(=O)OC)C/C(C)=C/[C@@H](O)C[C@@H]1COC(=O)C(C)(C)C |
| InChI | InChI=1S/C27H42O8/c1-18-13-20(28)15-19(16-34-25(31)26(2,3)4)22(35-17-32-7)11-9-10-12-27(5,6)23(29)21(14-18)24(30)33-8/h9-13,19-22,28H,14-17H2,1-8H3/b11-9+,12-10+,18-13+/t19-,20-,21?,22-/m1/s1 |
| InChIKey | VMALLNRSTYVYCK-VPLICCKMSA-N |
| XLogP | 3.78 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|