C29H44O9 — CID 11016958
methyl (3E,5S,7R,8R,9E,11E)-5-acetyloxy-7-(2,2-dimethylpropanoyloxymethyl)-8-(methoxymethoxy)-3,13,13-trimethyl-14-oxocyclotetradeca-3,9,11-triene-1-carboxylate (PubChem CID 11016958) has the molecular formula C29H44O9 and a molecular weight of 536.66 g/mol. Its IUPAC name is methyl (3E,5S,7R,8R,9E,11E)-5-acetyloxy-7-(2,2-dimethylpropanoyloxymethyl)-8-(methoxymethoxy)-3,13,13-trimethyl-14-oxocyclotetradeca-3,9,11-triene-1-carboxylate.
| Compound Name | methyl (3E,5S,7R,8R,9E,11E)-5-acetyloxy-7-(2,2-dimethylpropanoyloxymethyl)-8-(methoxymethoxy)-3,13,13-trimethyl-14-oxocyclotetradeca-3,9,11-triene-1-carboxylate |
|---|---|
| PubChem CID | 11016958 |
| Molecular Formula | C29H44O9 |
| Molecular Weight | 536.66 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | methyl (3E,5S,7R,8R,9E,11E)-5-acetyloxy-7-(2,2-dimethylpropanoyloxymethyl)-8-(methoxymethoxy)-3,13,13-trimethyl-14-oxocyclotetradeca-3,9,11-triene-1-carboxylate |
| SMILES | COCO[C@@H]1/C=C/C=C/C(C)(C)C(=O)C(C(=O)OC)C/C(C)=C/[C@@H](OC(C)=O)C[C@@H]1COC(=O)C(C)(C)C |
| InChI | InChI=1S/C29H44O9/c1-19-14-22(38-20(2)30)16-21(17-36-27(33)28(3,4)5)24(37-18-34-8)12-10-11-13-29(6,7)25(31)23(15-19)26(32)35-9/h10-14,21-24H,15-18H2,1-9H3/b12-10+,13-11+,19-14+/t21-,22-,23?,24-/m1/s1 |
| InChIKey | BKQCFBUQHHUHLC-ZTDOKVKWSA-N |
| XLogP | 4.35 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|