C29H46O10 — CID 11103640
methyl (5E,7E,9R,10R,13E)-12-acetyloxy-10-(2,2-dimethylpropanoyloxymethyl)-15-hydroxy-9-(methoxymethoxy)-4,4,14-trimethyl-3-oxopentadeca-5,7,13-trienoate (PubChem CID 11103640) has the molecular formula C29H46O10 and a molecular weight of 554.68 g/mol. Its IUPAC name is methyl (5E,7E,9R,10R,13E)-12-acetyloxy-10-(2,2-dimethylpropanoyloxymethyl)-15-hydroxy-9-(methoxymethoxy)-4,4,14-trimethyl-3-oxopentadeca-5,7,13-trienoate.
| Compound Name | methyl (5E,7E,9R,10R,13E)-12-acetyloxy-10-(2,2-dimethylpropanoyloxymethyl)-15-hydroxy-9-(methoxymethoxy)-4,4,14-trimethyl-3-oxopentadeca-5,7,13-trienoate |
|---|---|
| PubChem CID | 11103640 |
| Molecular Formula | C29H46O10 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | methyl (5E,7E,9R,10R,13E)-12-acetyloxy-10-(2,2-dimethylpropanoyloxymethyl)-15-hydroxy-9-(methoxymethoxy)-4,4,14-trimethyl-3-oxopentadeca-5,7,13-trienoate |
| SMILES | COCO[C@H](/C=C/C=C/C(C)(C)C(=O)CC(=O)OC)[C@@H](COC(=O)C(C)(C)C)CC(/C=C(\C)CO)OC(C)=O |
| InChI | InChI=1S/C29H46O10/c1-20(17-30)14-23(39-21(2)31)15-22(18-37-27(34)28(3,4)5)24(38-19-35-8)12-10-11-13-29(6,7)25(32)16-26(33)36-9/h10-14,22-24,30H,15-19H2,1-9H3/b12-10+,13-11+,20-14+/t22-,23?,24-/m1/s1 |
| InChIKey | FXXIRCABSTXIMX-AVLSSEIISA-N |
| XLogP | 3.71 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|