C22H32O7 — CID 15466587
dimethyl (3Z,5E,7R,8R,11Z)-8-(methoxymethoxy)-7,11-dimethyl-13-oxocyclotetradeca-3,5,11-triene-1,1-dicarboxylate (PubChem CID 15466587) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is dimethyl (3Z,5E,7R,8R,11Z)-8-(methoxymethoxy)-7,11-dimethyl-13-oxocyclotetradeca-3,5,11-triene-1,1-dicarboxylate.
| Compound Name | dimethyl (3Z,5E,7R,8R,11Z)-8-(methoxymethoxy)-7,11-dimethyl-13-oxocyclotetradeca-3,5,11-triene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 15466587 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | dimethyl (3Z,5E,7R,8R,11Z)-8-(methoxymethoxy)-7,11-dimethyl-13-oxocyclotetradeca-3,5,11-triene-1,1-dicarboxylate |
| SMILES | COCO[C@@H]1CC/C(C)=C\C(=O)CC(C(=O)OC)(C(=O)OC)C/C=C\C=C\[C@H]1C |
| InChI | InChI=1S/C22H32O7/c1-16-10-11-19(29-15-26-3)17(2)9-7-6-8-12-22(20(24)27-4,21(25)28-5)14-18(23)13-16/h6-9,13,17,19H,10-12,14-15H2,1-5H3/b8-6-,9-7+,16-13-/t17-,19-/m1/s1 |
| InChIKey | KBSHDSQSTKEXJT-SCIYAJNXSA-N |
| XLogP | 3.15 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|