C18H30O6 — CID 11559221
[(E,4R,5R)-1-ethoxycarbonyloxy-3,5-dimethyl-6-oxooct-2-en-4-yl] 2,2-dimethylpropanoate (PubChem CID 11559221) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is [(E,4R,5R)-1-ethoxycarbonyloxy-3,5-dimethyl-6-oxooct-2-en-4-yl] 2,2-dimethylpropanoate.
| Compound Name | [(E,4R,5R)-1-ethoxycarbonyloxy-3,5-dimethyl-6-oxooct-2-en-4-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11559221 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | [(E,4R,5R)-1-ethoxycarbonyloxy-3,5-dimethyl-6-oxooct-2-en-4-yl] 2,2-dimethylpropanoate |
| SMILES | CCOC(=O)OC/C=C(\C)[C@H](OC(=O)C(C)(C)C)[C@@H](C)C(=O)CC |
| InChI | InChI=1S/C18H30O6/c1-8-14(19)13(4)15(24-16(20)18(5,6)7)12(3)10-11-23-17(21)22-9-2/h10,13,15H,8-9,11H2,1-7H3/b12-10+/t13-,15-/m0/s1 |
| InChIKey | IOWFYGMENGAOTB-PYHCZJRBSA-N |
| XLogP | 3.68 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|