C28H34N6O4 — CID 10885806
benzyl 2,4-bis(2,2-dimethylpropanoylamino)-8,9-dihydro-6H-pyrimido[4,5-b][1,6]naphthyridine-7-carboxylate (PubChem CID 10885806) has the molecular formula C28H34N6O4 and a molecular weight of 518.62 g/mol. Its IUPAC name is benzyl 2,4-bis(2,2-dimethylpropanoylamino)-8,9-dihydro-6H-pyrimido[4,5-b][1,6]naphthyridine-7-carboxylate.
| Compound Name | benzyl 2,4-bis(2,2-dimethylpropanoylamino)-8,9-dihydro-6H-pyrimido[4,5-b][1,6]naphthyridine-7-carboxylate |
|---|---|
| PubChem CID | 10885806 |
| Molecular Formula | C28H34N6O4 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | benzyl 2,4-bis(2,2-dimethylpropanoylamino)-8,9-dihydro-6H-pyrimido[4,5-b][1,6]naphthyridine-7-carboxylate |
| SMILES | CC(C)(C)C(=O)Nc1nc(NC(=O)C(C)(C)C)c2cc3c(nc2n1)CCN(C(=O)OCc1ccccc1)C3 |
| InChI | InChI=1S/C28H34N6O4/c1-27(2,3)23(35)30-22-19-14-18-15-34(26(37)38-16-17-10-8-7-9-11-17)13-12-20(18)29-21(19)31-25(32-22)33-24(36)28(4,5)6/h7-11,14H,12-13,15-16H2,1-6H3,(H2,29,30,31,32,33,35,36) |
| InChIKey | QKHHNCVXBHLGPM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |