C14H13ClF3N3O2 — CID 108859031
(Z)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyano-3-[2-hydroxyethyl(methyl)amino]prop-2-enamide (PubChem CID 108859031) has the molecular formula C14H13ClF3N3O2 and a molecular weight of 347.72 g/mol. Its IUPAC name is (Z)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyano-3-[2-hydroxyethyl(methyl)amino]prop-2-enamide.
| Compound Name | (Z)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyano-3-[2-hydroxyethyl(methyl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 108859031 |
| Molecular Formula | C14H13ClF3N3O2 |
| Molecular Weight | 347.72 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | (Z)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyano-3-[2-hydroxyethyl(methyl)amino]prop-2-enamide |
| SMILES | CN(/C=C(/C#N)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)CCO |
| InChI | InChI=1S/C14H13ClF3N3O2/c1-21(4-5-22)8-9(7-19)13(23)20-10-2-3-12(15)11(6-10)14(16,17)18/h2-3,6,8,22H,4-5H2,1H3,(H,20,23)/b9-8- |
| InChIKey | ZHQALQCYXGYGSP-HJWRWDBZSA-N |
| XLogP | 2.63 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.72 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|