C17H15ClN4O2 — CID 108859644
(Z)-N-(4-amino-3-chlorophenyl)-2-cyano-3-(4-hydroxy-N-methylanilino)prop-2-enamide (PubChem CID 108859644) has the molecular formula C17H15ClN4O2 and a molecular weight of 342.79 g/mol. Its IUPAC name is (Z)-N-(4-amino-3-chlorophenyl)-2-cyano-3-(4-hydroxy-N-methylanilino)prop-2-enamide.
| Compound Name | (Z)-N-(4-amino-3-chlorophenyl)-2-cyano-3-(4-hydroxy-N-methylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108859644 |
| Molecular Formula | C17H15ClN4O2 |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | (Z)-N-(4-amino-3-chlorophenyl)-2-cyano-3-(4-hydroxy-N-methylanilino)prop-2-enamide |
| SMILES | CN(/C=C(/C#N)C(=O)Nc1ccc(N)c(Cl)c1)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H15ClN4O2/c1-22(13-3-5-14(23)6-4-13)10-11(9-19)17(24)21-12-2-7-16(20)15(18)8-12/h2-8,10,23H,20H2,1H3,(H,21,24)/b11-10- |
| InChIKey | QVNVGAJCGJHITR-KHPPLWFESA-N |
| XLogP | 3.11 |
| TPSA | 102.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|