C20H19ClFN5O — CID 108859803
(Z)-N-(4-amino-2-chlorophenyl)-2-cyano-3-[4-(2-fluorophenyl)piperazin-1-yl]prop-2-enamide (PubChem CID 108859803) has the molecular formula C20H19ClFN5O and a molecular weight of 399.86 g/mol. Its IUPAC name is (Z)-N-(4-amino-2-chlorophenyl)-2-cyano-3-[4-(2-fluorophenyl)piperazin-1-yl]prop-2-enamide.
| Compound Name | (Z)-N-(4-amino-2-chlorophenyl)-2-cyano-3-[4-(2-fluorophenyl)piperazin-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 108859803 |
| Molecular Formula | C20H19ClFN5O |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | (Z)-N-(4-amino-2-chlorophenyl)-2-cyano-3-[4-(2-fluorophenyl)piperazin-1-yl]prop-2-enamide |
| SMILES | N#C/C(=C/N1CCN(c2ccccc2F)CC1)C(=O)Nc1ccc(N)cc1Cl |
| InChI | InChI=1S/C20H19ClFN5O/c21-16-11-15(24)5-6-18(16)25-20(28)14(12-23)13-26-7-9-27(10-8-26)19-4-2-1-3-17(19)22/h1-6,11,13H,7-10,24H2,(H,25,28)/b14-13- |
| InChIKey | YMPDJSJJRJNFJW-YPKPFQOOSA-N |
| XLogP | 3.23 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|