C20H25FN4O3 — CID 108846458
2-[[(Z)-2-cyano-3-[4-(2-fluorophenyl)piperazin-1-yl]prop-2-enoyl]amino]-4-methylpentanoic acid (PubChem CID 108846458) has the molecular formula C20H25FN4O3 and a molecular weight of 388.44 g/mol. Its IUPAC name is 2-[[(Z)-2-cyano-3-[4-(2-fluorophenyl)piperazin-1-yl]prop-2-enoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[(Z)-2-cyano-3-[4-(2-fluorophenyl)piperazin-1-yl]prop-2-enoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 108846458 |
| Molecular Formula | C20H25FN4O3 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-[[(Z)-2-cyano-3-[4-(2-fluorophenyl)piperazin-1-yl]prop-2-enoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)/C(C#N)=C\N1CCN(c2ccccc2F)CC1)C(=O)O |
| InChI | InChI=1S/C20H25FN4O3/c1-14(2)11-17(20(27)28)23-19(26)15(12-22)13-24-7-9-25(10-8-24)18-6-4-3-5-16(18)21/h3-6,13-14,17H,7-11H2,1-2H3,(H,23,26)(H,27,28)/b15-13- |
| InChIKey | ONKNBIBCPOHNCW-SQFISAMPSA-N |
| XLogP | 1.97 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|