C15H27N5O — CID 108864059
(Z)-3-[butyl(methyl)amino]-2-cyano-N-(2-piperazin-1-ylethyl)prop-2-enamide (PubChem CID 108864059) has the molecular formula C15H27N5O and a molecular weight of 293.41 g/mol. Its IUPAC name is (Z)-3-[butyl(methyl)amino]-2-cyano-N-(2-piperazin-1-ylethyl)prop-2-enamide.
| Compound Name | (Z)-3-[butyl(methyl)amino]-2-cyano-N-(2-piperazin-1-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108864059 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | (Z)-3-[butyl(methyl)amino]-2-cyano-N-(2-piperazin-1-ylethyl)prop-2-enamide |
| SMILES | CCCCN(C)/C=C(/C#N)C(=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C15H27N5O/c1-3-4-8-19(2)13-14(12-16)15(21)18-7-11-20-9-5-17-6-10-20/h13,17H,3-11H2,1-2H3,(H,18,21)/b14-13- |
| InChIKey | XVGJIMWQDPTJDO-YPKPFQOOSA-N |
| XLogP | 0.15 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|