C34H24Br2N4S — CID 10886939
4,7-bis[2-(1-benzylpyridin-1-ium-3-yl)ethynyl]-2,1,3-benzothiadiazole dibromide (PubChem CID 10886939) has the molecular formula C34H24Br2N4S and a molecular weight of 680.47 g/mol. Its IUPAC name is 4,7-bis[2-(1-benzylpyridin-1-ium-3-yl)ethynyl]-2,1,3-benzothiadiazole dibromide.
| Compound Name | 4,7-bis[2-(1-benzylpyridin-1-ium-3-yl)ethynyl]-2,1,3-benzothiadiazole dibromide |
|---|---|
| PubChem CID | 10886939 |
| Molecular Formula | C34H24Br2N4S |
| Molecular Weight | 680.47 g/mol |
| Exact Mass | 678.01 |
| IUPAC Name | 4,7-bis[2-(1-benzylpyridin-1-ium-3-yl)ethynyl]-2,1,3-benzothiadiazole dibromide |
| SMILES | C(#Cc1ccc(C#Cc2ccc[n+](Cc3ccccc3)c2)c2nsnc12)c1ccc[n+](Cc2ccccc2)c1.[Br-].[Br-] |
| InChI | InChI=1S/C34H24N4S.2BrH/c1-3-9-27(10-4-1)23-37-21-7-13-29(25-37)15-17-31-19-20-32(34-33(31)35-39-36-34)18-16-30-14-8-22-38(26-30)24-28-11-5-2-6-12-28;;/h1-14,19-22,25-26H,23-24H2;2*1H/q+2;;/p-2 |
| InChIKey | YPVCWLHHAGGPTD-UHFFFAOYSA-L |
| XLogP | -0.83 |
| TPSA | 33.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.47 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|