C44H42F4O4 — CID 10887045
3-(4,5-difluoro-2-hexoxyphenyl)-1-[3-(4,5-difluoro-2-hexoxyphenyl)-2-hydroxynaphthalen-1-yl]naphthalen-2-ol (PubChem CID 10887045) has the molecular formula C44H42F4O4 and a molecular weight of 710.81 g/mol. Its IUPAC name is 3-(4,5-difluoro-2-hexoxyphenyl)-1-[3-(4,5-difluoro-2-hexoxyphenyl)-2-hydroxynaphthalen-1-yl]naphthalen-2-ol.
| Compound Name | 3-(4,5-difluoro-2-hexoxyphenyl)-1-[3-(4,5-difluoro-2-hexoxyphenyl)-2-hydroxynaphthalen-1-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 10887045 |
| Molecular Formula | C44H42F4O4 |
| Molecular Weight | 710.81 g/mol |
| Exact Mass | 710.30 |
| IUPAC Name | 3-(4,5-difluoro-2-hexoxyphenyl)-1-[3-(4,5-difluoro-2-hexoxyphenyl)-2-hydroxynaphthalen-1-yl]naphthalen-2-ol |
| SMILES | CCCCCCOc1cc(F)c(F)cc1-c1cc2ccccc2c(-c2c(O)c(-c3cc(F)c(F)cc3OCCCCCC)cc3ccccc23)c1O |
| InChI | InChI=1S/C44H42F4O4/c1-3-5-7-13-19-51-39-25-37(47)35(45)23-31(39)33-21-27-15-9-11-17-29(27)41(43(33)49)42-30-18-12-10-16-28(30)22-34(44(42)50)32-24-36(46)38(48)26-40(32)52-20-14-8-6-4-2/h9-12,15-18,21-26,49-50H,3-8,13-14,19-20H2,1-2H3 |
| InChIKey | QBAFTRQOJIXDPW-UHFFFAOYSA-N |
| XLogP | 12.88 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.81 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|