C10H14N2O5 — CID 108871812
1-(2-hydroxypropyl)-3-(3,4,5-trihydroxyphenyl)urea (PubChem CID 108871812) has the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. Its IUPAC name is 1-(2-hydroxypropyl)-3-(3,4,5-trihydroxyphenyl)urea.
| Compound Name | 1-(2-hydroxypropyl)-3-(3,4,5-trihydroxyphenyl)urea |
|---|---|
| PubChem CID | 108871812 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 1-(2-hydroxypropyl)-3-(3,4,5-trihydroxyphenyl)urea |
| SMILES | CC(O)CNC(=O)Nc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C10H14N2O5/c1-5(13)4-11-10(17)12-6-2-7(14)9(16)8(15)3-6/h2-3,5,13-16H,4H2,1H3,(H2,11,12,17) |
| InChIKey | HBOUCQZUNXUWJG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|