C11H9BrN2O5S — CID 108872785
3-[(5-bromofuran-2-yl)carbamoylamino]benzenesulfonic acid (PubChem CID 108872785) has the molecular formula C11H9BrN2O5S and a molecular weight of 361.17 g/mol. Its IUPAC name is 3-[(5-bromofuran-2-yl)carbamoylamino]benzenesulfonic acid.
| Compound Name | 3-[(5-bromofuran-2-yl)carbamoylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108872785 |
| Molecular Formula | C11H9BrN2O5S |
| Molecular Weight | 361.17 g/mol |
| Exact Mass | 359.94 |
| IUPAC Name | 3-[(5-bromofuran-2-yl)carbamoylamino]benzenesulfonic acid |
| SMILES | O=C(Nc1cccc(S(=O)(=O)O)c1)Nc1ccc(Br)o1 |
| InChI | InChI=1S/C11H9BrN2O5S/c12-9-4-5-10(19-9)14-11(15)13-7-2-1-3-8(6-7)20(16,17)18/h1-6H,(H2,13,14,15)(H,16,17,18) |
| InChIKey | IHFFLLAULVEVAU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.17 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|