C15H22N2O4S — CID 108878420
3-[(2,3-dimethylphenoxy)methyl]-1-(1,1-dioxothiolan-3-yl)-1-methylurea (PubChem CID 108878420) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is 3-[(2,3-dimethylphenoxy)methyl]-1-(1,1-dioxothiolan-3-yl)-1-methylurea.
| Compound Name | 3-[(2,3-dimethylphenoxy)methyl]-1-(1,1-dioxothiolan-3-yl)-1-methylurea |
|---|---|
| PubChem CID | 108878420 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 3-[(2,3-dimethylphenoxy)methyl]-1-(1,1-dioxothiolan-3-yl)-1-methylurea |
| SMILES | Cc1cccc(OCNC(=O)N(C)C2CCS(=O)(=O)C2)c1C |
| InChI | InChI=1S/C15H22N2O4S/c1-11-5-4-6-14(12(11)2)21-10-16-15(18)17(3)13-7-8-22(19,20)9-13/h4-6,13H,7-10H2,1-3H3,(H,16,18) |
| InChIKey | PICVGLIBWNMYKI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|