C13H17BrN2O3 — CID 108898028
ethyl 3-[(2-bromophenyl)methylcarbamoylamino]propanoate (PubChem CID 108898028) has the molecular formula C13H17BrN2O3 and a molecular weight of 329.19 g/mol. Its IUPAC name is ethyl 3-[(2-bromophenyl)methylcarbamoylamino]propanoate.
| Compound Name | ethyl 3-[(2-bromophenyl)methylcarbamoylamino]propanoate |
|---|---|
| PubChem CID | 108898028 |
| Molecular Formula | C13H17BrN2O3 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | ethyl 3-[(2-bromophenyl)methylcarbamoylamino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)NCc1ccccc1Br |
| InChI | InChI=1S/C13H17BrN2O3/c1-2-19-12(17)7-8-15-13(18)16-9-10-5-3-4-6-11(10)14/h3-6H,2,7-9H2,1H3,(H2,15,16,18) |
| InChIKey | XRDMLOXKYXBXQP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |