C11H15N5O — CID 10889815
2-(6-aminopurin-9-yl)-2,3-dimethylbut-3-en-1-ol (PubChem CID 10889815) has the molecular formula C11H15N5O and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-(6-aminopurin-9-yl)-2,3-dimethylbut-3-en-1-ol.
| Compound Name | 2-(6-aminopurin-9-yl)-2,3-dimethylbut-3-en-1-ol |
|---|---|
| PubChem CID | 10889815 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 2-(6-aminopurin-9-yl)-2,3-dimethylbut-3-en-1-ol |
| SMILES | C=C(C)C(C)(CO)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C11H15N5O/c1-7(2)11(3,4-17)16-6-15-8-9(12)13-5-14-10(8)16/h5-6,17H,1,4H2,2-3H3,(H2,12,13,14) |
| InChIKey | HMJROSAZDHLHIF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|