C17H17N3OS — CID 108899741
[4-[2-(2-methylphenyl)ethylcarbamoylamino]phenyl] thiocyanate (PubChem CID 108899741) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is [4-[2-(2-methylphenyl)ethylcarbamoylamino]phenyl] thiocyanate.
| Compound Name | [4-[2-(2-methylphenyl)ethylcarbamoylamino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108899741 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | [4-[2-(2-methylphenyl)ethylcarbamoylamino]phenyl] thiocyanate |
| SMILES | Cc1ccccc1CCNC(=O)Nc1ccc(SC#N)cc1 |
| InChI | InChI=1S/C17H17N3OS/c1-13-4-2-3-5-14(13)10-11-19-17(21)20-15-6-8-16(9-7-15)22-12-18/h2-9H,10-11H2,1H3,(H2,19,20,21) |
| InChIKey | OTSFILWVBGXIOC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|