C14H17N3OS — CID 108914758
[4-[[(E)-2,3-dimethylbut-1-enyl]carbamoylamino]phenyl] thiocyanate (PubChem CID 108914758) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is [4-[[(E)-2,3-dimethylbut-1-enyl]carbamoylamino]phenyl] thiocyanate.
| Compound Name | [4-[[(E)-2,3-dimethylbut-1-enyl]carbamoylamino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108914758 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | [4-[[(E)-2,3-dimethylbut-1-enyl]carbamoylamino]phenyl] thiocyanate |
| SMILES | C/C(=C\NC(=O)Nc1ccc(SC#N)cc1)C(C)C |
| InChI | InChI=1S/C14H17N3OS/c1-10(2)11(3)8-16-14(18)17-12-4-6-13(7-5-12)19-9-15/h4-8,10H,1-3H3,(H2,16,17,18)/b11-8+ |
| InChIKey | GCYPPWLHKPOZGA-DHZHZOJOSA-N |
| XLogP | 3.94 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|