C15H23BrN4O — CID 108902319
1-[2-(4-bromophenyl)ethyl]-3-(2-piperazin-1-ylethyl)urea (PubChem CID 108902319) has the molecular formula C15H23BrN4O and a molecular weight of 355.28 g/mol. Its IUPAC name is 1-[2-(4-bromophenyl)ethyl]-3-(2-piperazin-1-ylethyl)urea.
| Compound Name | 1-[2-(4-bromophenyl)ethyl]-3-(2-piperazin-1-ylethyl)urea |
|---|---|
| PubChem CID | 108902319 |
| Molecular Formula | C15H23BrN4O |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 1-[2-(4-bromophenyl)ethyl]-3-(2-piperazin-1-ylethyl)urea |
| SMILES | O=C(NCCc1ccc(Br)cc1)NCCN1CCNCC1 |
| InChI | InChI=1S/C15H23BrN4O/c16-14-3-1-13(2-4-14)5-6-18-15(21)19-9-12-20-10-7-17-8-11-20/h1-4,17H,5-12H2,(H2,18,19,21) |
| InChIKey | GROCUWBFLXEPFU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |