C15H23BrClN3OS — CID 119449060
2-(4-bromophenyl)sulfanyl-N-(2-piperazin-1-ylethyl)propanamide;hydrochloride (PubChem CID 119449060) has the molecular formula C15H23BrClN3OS and a molecular weight of 408.79 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-N-(2-piperazin-1-ylethyl)propanamide;hydrochloride.
| Compound Name | 2-(4-bromophenyl)sulfanyl-N-(2-piperazin-1-ylethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119449060 |
| Molecular Formula | C15H23BrClN3OS |
| Molecular Weight | 408.79 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-N-(2-piperazin-1-ylethyl)propanamide;hydrochloride |
| SMILES | CC(Sc1ccc(Br)cc1)C(=O)NCCN1CCNCC1.Cl |
| InChI | InChI=1S/C15H22BrN3OS.ClH/c1-12(21-14-4-2-13(16)3-5-14)15(20)18-8-11-19-9-6-17-7-10-19;/h2-5,12,17H,6-11H2,1H3,(H,18,20);1H |
| InChIKey | XTGVRZWYCSKXTL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.79 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |