C14H22O4 — CID 10890456
ethyl 4-[(3S,3aR,7aS)-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-3-yl]-2-methylidenebutanoate (PubChem CID 10890456) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is ethyl 4-[(3S,3aR,7aS)-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-3-yl]-2-methylidenebutanoate.
| Compound Name | ethyl 4-[(3S,3aR,7aS)-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-3-yl]-2-methylidenebutanoate |
|---|---|
| PubChem CID | 10890456 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | ethyl 4-[(3S,3aR,7aS)-3,3a,4,5,6,7a-hexahydro-2H-furo[2,3-b]pyran-3-yl]-2-methylidenebutanoate |
| SMILES | C=C(CC[C@@H]1CO[C@@H]2OCCC[C@H]12)C(=O)OCC |
| InChI | InChI=1S/C14H22O4/c1-3-16-13(15)10(2)6-7-11-9-18-14-12(11)5-4-8-17-14/h11-12,14H,2-9H2,1H3/t11-,12-,14+/m1/s1 |
| InChIKey | VGYFFGAZXBORTE-BZPMIXESSA-N |
| XLogP | 2.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|