C12H16O5 — CID 70130651
methyl (1R,3S,4R,7S,11S)-3-methoxy-2,10-dioxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate (PubChem CID 70130651) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is methyl (1R,3S,4R,7S,11S)-3-methoxy-2,10-dioxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate.
| Compound Name | methyl (1R,3S,4R,7S,11S)-3-methoxy-2,10-dioxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate |
|---|---|
| PubChem CID | 70130651 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | methyl (1R,3S,4R,7S,11S)-3-methoxy-2,10-dioxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H]2O[C@H](OC)[C@@H]3CC[C@H]1[C@H]23 |
| InChI | InChI=1S/C12H16O5/c1-14-10(13)8-5-16-12-9-6(8)3-4-7(9)11(15-2)17-12/h5-7,9,11-12H,3-4H2,1-2H3/t6-,7-,9+,11+,12-/m1/s1 |
| InChIKey | NEMXAGILNCNDAM-IMBSYMQOSA-N |
| XLogP | 1.04 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |