C15H26O4 — CID 11129378
ethyl 4-[(3R,5S)-5-butoxyoxolan-3-yl]-2-methylidenebutanoate (PubChem CID 11129378) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is ethyl 4-[(3R,5S)-5-butoxyoxolan-3-yl]-2-methylidenebutanoate.
| Compound Name | ethyl 4-[(3R,5S)-5-butoxyoxolan-3-yl]-2-methylidenebutanoate |
|---|---|
| PubChem CID | 11129378 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | ethyl 4-[(3R,5S)-5-butoxyoxolan-3-yl]-2-methylidenebutanoate |
| SMILES | C=C(CC[C@H]1CO[C@H](OCCCC)C1)C(=O)OCC |
| InChI | InChI=1S/C15H26O4/c1-4-6-9-18-14-10-13(11-19-14)8-7-12(3)15(16)17-5-2/h13-14H,3-11H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | PZYRPNGCBOKZEI-KGLIPLIRSA-N |
| XLogP | 3.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|