C13H20O4 — CID 10681505
ethyl 4-[(3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]-2-methylidenebutanoate (PubChem CID 10681505) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is ethyl 4-[(3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]-2-methylidenebutanoate.
| Compound Name | ethyl 4-[(3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]-2-methylidenebutanoate |
|---|---|
| PubChem CID | 10681505 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | ethyl 4-[(3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]-2-methylidenebutanoate |
| SMILES | C=C(CC[C@@H]1CO[C@@H]2OCC[C@H]12)C(=O)OCC |
| InChI | InChI=1S/C13H20O4/c1-3-15-12(14)9(2)4-5-10-8-17-13-11(10)6-7-16-13/h10-11,13H,2-8H2,1H3/t10-,11-,13+/m1/s1 |
| InChIKey | VDGHJTIHACAYRS-WZRBSPASSA-N |
| XLogP | 1.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|