C11H14O4 — CID 11063696
(1S,3R,4R,7S,11S)-3-methoxy-8-methylidene-2,10-dioxatricyclo[5.3.1.04,11]undecan-9-one (PubChem CID 11063696) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is (1S,3R,4R,7S,11S)-3-methoxy-8-methylidene-2,10-dioxatricyclo[5.3.1.04,11]undecan-9-one.
| Compound Name | (1S,3R,4R,7S,11S)-3-methoxy-8-methylidene-2,10-dioxatricyclo[5.3.1.04,11]undecan-9-one |
|---|---|
| PubChem CID | 11063696 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (1S,3R,4R,7S,11S)-3-methoxy-8-methylidene-2,10-dioxatricyclo[5.3.1.04,11]undecan-9-one |
| SMILES | C=C1C(=O)O[C@@H]2O[C@@H](OC)[C@@H]3CC[C@H]1[C@H]23 |
| InChI | InChI=1S/C11H14O4/c1-5-6-3-4-7-8(6)11(14-9(5)12)15-10(7)13-2/h6-8,10-11H,1,3-4H2,2H3/t6-,7-,8+,10-,11-/m1/s1 |
| InChIKey | BQKYCWBNMSAUDZ-DBPGGULWSA-N |
| XLogP | 1.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|