C17H24O6 — CID 57055334
2-methylprop-2-enoyl 7-hydroxy-3-methyl-2-methylidene-7-(2-methylprop-2-enoyloxy)heptanoate (PubChem CID 57055334) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is 2-methylprop-2-enoyl 7-hydroxy-3-methyl-2-methylidene-7-(2-methylprop-2-enoyloxy)heptanoate.
| Compound Name | 2-methylprop-2-enoyl 7-hydroxy-3-methyl-2-methylidene-7-(2-methylprop-2-enoyloxy)heptanoate |
|---|---|
| PubChem CID | 57055334 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-methylprop-2-enoyl 7-hydroxy-3-methyl-2-methylidene-7-(2-methylprop-2-enoyloxy)heptanoate |
| SMILES | C=C(C)C(=O)OC(=O)C(=C)C(C)CCCC(O)OC(=O)C(=C)C |
| InChI | InChI=1S/C17H24O6/c1-10(2)15(19)22-14(18)9-7-8-12(5)13(6)17(21)23-16(20)11(3)4/h12,14,18H,1,3,6-9H2,2,4-5H3 |
| InChIKey | QYAOMBFAGMGQBH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|