C15H19BrN2O — CID 108904972
N-[(E)-2-(2-bromophenyl)ethenyl]-4-methylpiperidine-1-carboxamide (PubChem CID 108904972) has the molecular formula C15H19BrN2O and a molecular weight of 323.23 g/mol. Its IUPAC name is N-[(E)-2-(2-bromophenyl)ethenyl]-4-methylpiperidine-1-carboxamide.
| Compound Name | N-[(E)-2-(2-bromophenyl)ethenyl]-4-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 108904972 |
| Molecular Formula | C15H19BrN2O |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | N-[(E)-2-(2-bromophenyl)ethenyl]-4-methylpiperidine-1-carboxamide |
| SMILES | CC1CCN(C(=O)N/C=C/c2ccccc2Br)CC1 |
| InChI | InChI=1S/C15H19BrN2O/c1-12-7-10-18(11-8-12)15(19)17-9-6-13-4-2-3-5-14(13)16/h2-6,9,12H,7-8,10-11H2,1H3,(H,17,19)/b9-6+ |
| InChIKey | VIQSICPMKMVQIC-RMKNXTFCSA-N |
| XLogP | 3.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |