C21H27ClN2O — CID 108906493
1-[1-(1-adamantyl)ethyl]-3-[(E)-2-(3-chlorophenyl)ethenyl]urea (PubChem CID 108906493) has the molecular formula C21H27ClN2O and a molecular weight of 358.91 g/mol. Its IUPAC name is 1-[1-(1-adamantyl)ethyl]-3-[(E)-2-(3-chlorophenyl)ethenyl]urea.
| Compound Name | 1-[1-(1-adamantyl)ethyl]-3-[(E)-2-(3-chlorophenyl)ethenyl]urea |
|---|---|
| PubChem CID | 108906493 |
| Molecular Formula | C21H27ClN2O |
| Molecular Weight | 358.91 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 1-[1-(1-adamantyl)ethyl]-3-[(E)-2-(3-chlorophenyl)ethenyl]urea |
| SMILES | CC(NC(=O)N/C=C/c1cccc(Cl)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H27ClN2O/c1-14(21-11-16-7-17(12-21)9-18(8-16)13-21)24-20(25)23-6-5-15-3-2-4-19(22)10-15/h2-6,10,14,16-18H,7-9,11-13H2,1H3,(H2,23,24,25)/b6-5+ |
| InChIKey | ZJGLFSLKICWXGB-AATRIKPKSA-N |
| XLogP | 5.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.91 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |