About 1-[(E)-2-(3-chlorophenyl)ethenyl]-3-(4,5-dihydro-1,3-thiazol-2-yl)urea
1-[(E)-2-(3-chlorophenyl)ethenyl]-3-(4,5-dihydro-1,3-thiazol-2-yl)urea (PubChem CID 108906672) has the molecular formula C12H12ClN3OS
and a molecular weight of 281.77 g/mol. Its IUPAC name is 1-[(E)-2-(3-chlorophenyl)ethenyl]-3-(4,5-dihydro-1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-[(E)-2-(3-chlorophenyl)ethenyl]-3-(4,5-dihydro-1,3-thiazol-2-yl)urea |
| PubChem CID | 108906672 |
| Molecular Formula | C12H12ClN3OS |
| Molecular Weight | 281.77 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 1-[(E)-2-(3-chlorophenyl)ethenyl]-3-(4,5-dihydro-1,3-thiazol-2-yl)urea |
| SMILES | O=C(N/C=C/c1cccc(Cl)c1)NC1=NCCS1 |
| InChI | InChI=1S/C12H12ClN3OS/c13-10-3-1-2-9(8-10)4-5-14-11(17)16-12-15-6-7-18-12/h1-5,8H,6-7H2,(H2,14,15,16,17)/b5-4+ |
| InChIKey | DWGFVEKPSAMBRL-SNAWJCMRSA-N |
| XLogP | 2.71 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.77 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(E)-2-(3-chlorophenyl)ethenyl]-3-(4,5-dihydro-1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-2-(3-chlorophenyl)ethenyl]-3-(4,5-dihydro-1,3-thiazol-2-yl)urea?
The IUPAC name of 1-[(E)-2-(3-chlorophenyl)ethenyl]-3-(4,5-dihydro-1,3-thiazol-2-yl)urea (CID 108906672) is 1-[(E)-2-(3-chlorophenyl)ethenyl]-3-(4,5-dihydro-1,3-thiazol-2-yl)urea.
What is the SMILES notation for 1-[(E)-2-(3-chlorophenyl)ethenyl]-3-(4,5-dihydro-1,3-thiazol-2-yl)urea?
The canonical SMILES for 1-[(E)-2-(3-chlorophenyl)ethenyl]-3-(4,5-dihydro-1,3-thiazol-2-yl)urea is O=C(N/C=C/c1cccc(Cl)c1)NC1=NCCS1.
What is the InChIKey of 1-[(E)-2-(3-chlorophenyl)ethenyl]-3-(4,5-dihydro-1,3-thiazol-2-yl)urea?
The InChIKey is DWGFVEKPSAMBRL-SNAWJCMRSA-N. The full InChI is InChI=1S/C12H12ClN3OS/c13-10-3-1-2-9(8-10)4-5-14-11(17)16-12-15-6-7-18-12/h1-5,8H,6-7H2,(H2,14,15,16,17)/b5-4+.
What are the key properties of 1-[(E)-2-(3-chlorophenyl)ethenyl]-3-(4,5-dihydro-1,3-thiazol-2-yl)urea?
1-[(E)-2-(3-chlorophenyl)ethenyl]-3-(4,5-dihydro-1,3-thiazol-2-yl)urea has a molecular weight of 281.77 g/mol, XLogP of 2.71, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-2-(3-chlorophenyl)ethenyl]-3-(4,5-dihydro-1,3-thiazol-2-yl)urea is sourced from PubChem (CID 108906672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).