C14H17BrN2O3S — CID 108906877
2-[[(E)-2-(3-bromophenyl)ethenyl]carbamoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 108906877) has the molecular formula C14H17BrN2O3S and a molecular weight of 373.27 g/mol. Its IUPAC name is 2-[[(E)-2-(3-bromophenyl)ethenyl]carbamoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[(E)-2-(3-bromophenyl)ethenyl]carbamoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 108906877 |
| Molecular Formula | C14H17BrN2O3S |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 2-[[(E)-2-(3-bromophenyl)ethenyl]carbamoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)N/C=C/c1cccc(Br)c1)C(=O)O |
| InChI | InChI=1S/C14H17BrN2O3S/c1-21-8-6-12(13(18)19)17-14(20)16-7-5-10-3-2-4-11(15)9-10/h2-5,7,9,12H,6,8H2,1H3,(H,18,19)(H2,16,17,20)/b7-5+ |
| InChIKey | AQGNREPYLHCCCF-FNORWQNLSA-N |
| XLogP | 2.93 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |