C14H18O7 — CID 10891851
[(2E,3R,4R,5S)-4-acetyloxy-2-(2-oxoethylidene)-1,10-dioxaspiro[4.5]decan-3-yl] acetate (PubChem CID 10891851) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is [(2E,3R,4R,5S)-4-acetyloxy-2-(2-oxoethylidene)-1,10-dioxaspiro[4.5]decan-3-yl] acetate.
| Compound Name | [(2E,3R,4R,5S)-4-acetyloxy-2-(2-oxoethylidene)-1,10-dioxaspiro[4.5]decan-3-yl] acetate |
|---|---|
| PubChem CID | 10891851 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [(2E,3R,4R,5S)-4-acetyloxy-2-(2-oxoethylidene)-1,10-dioxaspiro[4.5]decan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)/C(=C\C=O)O[C@@]12CCCCO2 |
| InChI | InChI=1S/C14H18O7/c1-9(16)19-12-11(5-7-15)21-14(6-3-4-8-18-14)13(12)20-10(2)17/h5,7,12-13H,3-4,6,8H2,1-2H3/b11-5+/t12-,13+,14-/m0/s1 |
| InChIKey | ZUOFFRXUADRBMF-BTCPNLIFSA-N |
| XLogP | 0.86 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|