C17H24O5 — CID 10892205
2-[2-hydroxy-4-(oxan-2-yloxy)hept-6-enyl]pyran-4-one (PubChem CID 10892205) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is 2-[2-hydroxy-4-(oxan-2-yloxy)hept-6-enyl]pyran-4-one.
| Compound Name | 2-[2-hydroxy-4-(oxan-2-yloxy)hept-6-enyl]pyran-4-one |
|---|---|
| PubChem CID | 10892205 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-[2-hydroxy-4-(oxan-2-yloxy)hept-6-enyl]pyran-4-one |
| SMILES | C=CCC(CC(O)Cc1cc(=O)cco1)OC1CCCCO1 |
| InChI | InChI=1S/C17H24O5/c1-2-5-15(22-17-6-3-4-8-21-17)11-14(19)12-16-10-13(18)7-9-20-16/h2,7,9-10,14-15,17,19H,1,3-6,8,11-12H2 |
| InChIKey | SOFZBPOVWDJSCH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|