C18H21F3N6O2 — CID 1089222
4,6-dimorpholin-4-yl-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine (PubChem CID 1089222) has the molecular formula C18H21F3N6O2 and a molecular weight of 410.40 g/mol. Its IUPAC name is 4,6-dimorpholin-4-yl-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dimorpholin-4-yl-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 1089222 |
| Molecular Formula | C18H21F3N6O2 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 4,6-dimorpholin-4-yl-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine |
| SMILES | FC(F)(F)c1cccc(Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C18H21F3N6O2/c19-18(20,21)13-2-1-3-14(12-13)22-15-23-16(26-4-8-28-9-5-26)25-17(24-15)27-6-10-29-11-7-27/h1-3,12H,4-11H2,(H,22,23,24,25) |
| InChIKey | RGBPBGGWEXXNPH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |