C23H18N4O4 — CID 108925920
N-[2-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]phenyl]pyridine-3-carboxamide (PubChem CID 108925920) has the molecular formula C23H18N4O4 and a molecular weight of 414.42 g/mol. Its IUPAC name is N-[2-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 108925920 |
| Molecular Formula | C23H18N4O4 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | N-[2-[[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]methyl]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)NCc1ccccc1NC(=O)c1cccnc1 |
| InChI | InChI=1S/C23H18N4O4/c28-20(14-27-22(30)17-8-2-3-9-18(17)23(27)31)25-13-15-6-1-4-10-19(15)26-21(29)16-7-5-11-24-12-16/h1-12H,13-14H2,(H,25,28)(H,26,29) |
| InChIKey | WSNXPESZRWMQBQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|