C25H30N2O4 — CID 108927299
[3-[[1-[3-(3-methylphenyl)propanoyl]piperidin-4-yl]methylcarbamoyl]phenyl] acetate (PubChem CID 108927299) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is [3-[[1-[3-(3-methylphenyl)propanoyl]piperidin-4-yl]methylcarbamoyl]phenyl] acetate.
| Compound Name | [3-[[1-[3-(3-methylphenyl)propanoyl]piperidin-4-yl]methylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108927299 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | [3-[[1-[3-(3-methylphenyl)propanoyl]piperidin-4-yl]methylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NCC2CCN(C(=O)CCc3cccc(C)c3)CC2)c1 |
| InChI | InChI=1S/C25H30N2O4/c1-18-5-3-6-20(15-18)9-10-24(29)27-13-11-21(12-14-27)17-26-25(30)22-7-4-8-23(16-22)31-19(2)28/h3-8,15-16,21H,9-14,17H2,1-2H3,(H,26,30) |
| InChIKey | DNYCRYVVDYCUSU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|