C15H12FeO5 — CID 10892788
carbon monoxide;(3E)-2-ethoxy-4-phenylbuta-1,3-dien-1-one;iron (PubChem CID 10892788) has the molecular formula C15H12FeO5 and a molecular weight of 328.10 g/mol. Its IUPAC name is carbon monoxide;(3E)-2-ethoxy-4-phenylbuta-1,3-dien-1-one;iron.
| Compound Name | carbon monoxide;(3E)-2-ethoxy-4-phenylbuta-1,3-dien-1-one;iron |
|---|---|
| PubChem CID | 10892788 |
| Molecular Formula | C15H12FeO5 |
| Molecular Weight | 328.10 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | carbon monoxide;(3E)-2-ethoxy-4-phenylbuta-1,3-dien-1-one;iron |
| SMILES | CCOC(=C=O)/C=C/c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C12H12O2.3CO.Fe/c1-2-14-12(10-13)9-8-11-6-4-3-5-7-11;3*1-2;/h3-9H,2H2,1H3;;;;/b9-8+;;;; |
| InChIKey | SOHYRQXYPNTQHI-HUMMXKGPSA-N |
| XLogP | 2.34 |
| TPSA | 86.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.10 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|