C23H18Cl2N2O5 — CID 108928034
[3-[[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]phenyl]carbamoyl]phenyl] acetate (PubChem CID 108928034) has the molecular formula C23H18Cl2N2O5 and a molecular weight of 473.31 g/mol. Its IUPAC name is [3-[[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108928034 |
| Molecular Formula | C23H18Cl2N2O5 |
| Molecular Weight | 473.31 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | [3-[[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)Nc2ccccc2NC(=O)COc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C23H18Cl2N2O5/c1-14(28)32-17-6-4-5-15(11-17)23(30)27-20-8-3-2-7-19(20)26-22(29)13-31-21-10-9-16(24)12-18(21)25/h2-12H,13H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | AEGCMJMVOVQOMN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.31 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|