C9H13F3N2O2 — CID 108932627
3-methyl-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]but-2-enamide (PubChem CID 108932627) has the molecular formula C9H13F3N2O2 and a molecular weight of 238.21 g/mol. Its IUPAC name is 3-methyl-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]but-2-enamide.
| Compound Name | 3-methyl-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]but-2-enamide |
|---|---|
| PubChem CID | 108932627 |
| Molecular Formula | C9H13F3N2O2 |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 3-methyl-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]but-2-enamide |
| SMILES | CC(C)=CC(=O)NCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H13F3N2O2/c1-6(2)5-7(15)13-3-4-14-8(16)9(10,11)12/h5H,3-4H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | ILEOVKLFPXJTGF-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|