C16H23F3N2O2 — CID 108933089
N-[1-[(E)-3-cyclopentylbut-2-enoyl]piperidin-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 108933089) has the molecular formula C16H23F3N2O2 and a molecular weight of 332.37 g/mol. Its IUPAC name is N-[1-[(E)-3-cyclopentylbut-2-enoyl]piperidin-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[1-[(E)-3-cyclopentylbut-2-enoyl]piperidin-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 108933089 |
| Molecular Formula | C16H23F3N2O2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-[1-[(E)-3-cyclopentylbut-2-enoyl]piperidin-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | C/C(=C\C(=O)N1CCC(NC(=O)C(F)(F)F)CC1)C1CCCC1 |
| InChI | InChI=1S/C16H23F3N2O2/c1-11(12-4-2-3-5-12)10-14(22)21-8-6-13(7-9-21)20-15(23)16(17,18)19/h10,12-13H,2-9H2,1H3,(H,20,23)/b11-10+ |
| InChIKey | ZHQHFWPELKJIJM-ZHACJKMWSA-N |
| XLogP | 2.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|