C22H30O3S — CID 10894087
methyl (2S)-2-[(2R,4aR,5R,7R)-7-hydroxy-4a,8-dimethyl-5-phenylsulfanyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propanoate (PubChem CID 10894087) has the molecular formula C22H30O3S and a molecular weight of 374.55 g/mol. Its IUPAC name is methyl (2S)-2-[(2R,4aR,5R,7R)-7-hydroxy-4a,8-dimethyl-5-phenylsulfanyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propanoate.
| Compound Name | methyl (2S)-2-[(2R,4aR,5R,7R)-7-hydroxy-4a,8-dimethyl-5-phenylsulfanyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 10894087 |
| Molecular Formula | C22H30O3S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | methyl (2S)-2-[(2R,4aR,5R,7R)-7-hydroxy-4a,8-dimethyl-5-phenylsulfanyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)[C@@H]1CC[C@]2(C)C(=C(C)[C@H](O)C[C@H]2Sc2ccccc2)C1 |
| InChI | InChI=1S/C22H30O3S/c1-14(21(24)25-4)16-10-11-22(3)18(12-16)15(2)19(23)13-20(22)26-17-8-6-5-7-9-17/h5-9,14,16,19-20,23H,10-13H2,1-4H3/t14-,16+,19+,20+,22+/m0/s1 |
| InChIKey | HSQWGPMIPCZARO-FRLAPBMMSA-N |
| XLogP | 4.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|