C22H20O6 — CID 10894199
[2,5-dihydroxy-3,6-bis(4-methoxyphenyl)phenyl] acetate (PubChem CID 10894199) has the molecular formula C22H20O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is [2,5-dihydroxy-3,6-bis(4-methoxyphenyl)phenyl] acetate.
| Compound Name | [2,5-dihydroxy-3,6-bis(4-methoxyphenyl)phenyl] acetate |
|---|---|
| PubChem CID | 10894199 |
| Molecular Formula | C22H20O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [2,5-dihydroxy-3,6-bis(4-methoxyphenyl)phenyl] acetate |
| SMILES | COc1ccc(-c2cc(O)c(-c3ccc(OC)cc3)c(OC(C)=O)c2O)cc1 |
| InChI | InChI=1S/C22H20O6/c1-13(23)28-22-20(15-6-10-17(27-3)11-7-15)19(24)12-18(21(22)25)14-4-8-16(26-2)9-5-14/h4-12,24-25H,1-3H3 |
| InChIKey | PYWPPSLUWAHILN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|