C19H23N2+ — CID 10894474
(13R,14S,15E)-15-ethylidene-13-methyl-11-aza-1-azoniapentacyclo[12.2.2.01,13.04,12.05,10]octadeca-4(12),5,7,9-tetraene (PubChem CID 10894474) has the molecular formula C19H23N2+ and a molecular weight of 279.41 g/mol. Its IUPAC name is (13R,14S,15E)-15-ethylidene-13-methyl-11-aza-1-azoniapentacyclo[12.2.2.01,13.04,12.05,10]octadeca-4(12),5,7,9-tetraene.
| Compound Name | (13R,14S,15E)-15-ethylidene-13-methyl-11-aza-1-azoniapentacyclo[12.2.2.01,13.04,12.05,10]octadeca-4(12),5,7,9-tetraene |
|---|---|
| PubChem CID | 10894474 |
| Molecular Formula | C19H23N2+ |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | (13R,14S,15E)-15-ethylidene-13-methyl-11-aza-1-azoniapentacyclo[12.2.2.01,13.04,12.05,10]octadeca-4(12),5,7,9-tetraene |
| SMILES | C/C=C1/C[N+]23CCc4c([nH]c5ccccc45)[C@@]2(C)[C@H]1CC3 |
| InChI | InChI=1S/C19H23N2/c1-3-13-12-21-10-8-15-14-6-4-5-7-17(14)20-18(15)19(21,2)16(13)9-11-21/h3-7,16,20H,8-12H2,1-2H3/q+1/b13-3-/t16-,19+,21?/m0/s1 |
| InChIKey | YKFXXRDKXYTPFL-PBQVUPGISA-N |
| XLogP | 3.74 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|