C18H25N5O4 — CID 108949990
1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)propane-1,3-dione (PubChem CID 108949990) has the molecular formula C18H25N5O4 and a molecular weight of 375.43 g/mol. Its IUPAC name is 1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)propane-1,3-dione.
| Compound Name | 1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 108949990 |
| Molecular Formula | C18H25N5O4 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 1-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-(4-pyrimidin-2-ylpiperazin-1-yl)propane-1,3-dione |
| SMILES | O=C(CC(=O)N1CCC2(CC1)OCCO2)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H25N5O4/c24-15(21-6-2-18(3-7-21)26-12-13-27-18)14-16(25)22-8-10-23(11-9-22)17-19-4-1-5-20-17/h1,4-5H,2-3,6-14H2 |
| InChIKey | HGJZOYJNVJGYDC-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 88.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|