C14H18Cl2N2O2 — CID 108952098
N'-butyl-N-(3,5-dichlorophenyl)-N'-methylpropanediamide (PubChem CID 108952098) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is N'-butyl-N-(3,5-dichlorophenyl)-N'-methylpropanediamide.
| Compound Name | N'-butyl-N-(3,5-dichlorophenyl)-N'-methylpropanediamide |
|---|---|
| PubChem CID | 108952098 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | N'-butyl-N-(3,5-dichlorophenyl)-N'-methylpropanediamide |
| SMILES | CCCCN(C)C(=O)CC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2N2O2/c1-3-4-5-18(2)14(20)9-13(19)17-12-7-10(15)6-11(16)8-12/h6-8H,3-5,9H2,1-2H3,(H,17,19) |
| InChIKey | WXPSCXHPGYQIQR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|