C23H30O4S2 — CID 10895373
(1R,2R,3R,4S)-4-(hydroxymethyl)-5,5-bis(methylsulfanyl)-2,3-bis(phenylmethoxy)cyclohexan-1-ol (PubChem CID 10895373) has the molecular formula C23H30O4S2 and a molecular weight of 434.62 g/mol. Its IUPAC name is (1R,2R,3R,4S)-4-(hydroxymethyl)-5,5-bis(methylsulfanyl)-2,3-bis(phenylmethoxy)cyclohexan-1-ol.
| Compound Name | (1R,2R,3R,4S)-4-(hydroxymethyl)-5,5-bis(methylsulfanyl)-2,3-bis(phenylmethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 10895373 |
| Molecular Formula | C23H30O4S2 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | (1R,2R,3R,4S)-4-(hydroxymethyl)-5,5-bis(methylsulfanyl)-2,3-bis(phenylmethoxy)cyclohexan-1-ol |
| SMILES | CSC1(SC)C[C@@H](O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1CO |
| InChI | InChI=1S/C23H30O4S2/c1-28-23(29-2)13-20(25)22(27-16-18-11-7-4-8-12-18)21(19(23)14-24)26-15-17-9-5-3-6-10-17/h3-12,19-22,24-25H,13-16H2,1-2H3/t19-,20+,21+,22+/m0/s1 |
| InChIKey | YSWGRBPYOBBZRH-DXBBTUNJSA-N |
| XLogP | 3.95 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|