C27H26N4O3 — CID 10895701
(4E)-4-(4-ethylphenyl)-4-[[3-(4-methoxyphenyl)-1,8-naphthyridin-2-yl]hydrazinylidene]butanoic acid (PubChem CID 10895701) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is (4E)-4-(4-ethylphenyl)-4-[[3-(4-methoxyphenyl)-1,8-naphthyridin-2-yl]hydrazinylidene]butanoic acid.
| Compound Name | (4E)-4-(4-ethylphenyl)-4-[[3-(4-methoxyphenyl)-1,8-naphthyridin-2-yl]hydrazinylidene]butanoic acid |
|---|---|
| PubChem CID | 10895701 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (4E)-4-(4-ethylphenyl)-4-[[3-(4-methoxyphenyl)-1,8-naphthyridin-2-yl]hydrazinylidene]butanoic acid |
| SMILES | CCc1ccc(/C(CCC(=O)O)=N/Nc2nc3ncccc3cc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H26N4O3/c1-3-18-6-8-20(9-7-18)24(14-15-25(32)33)30-31-27-23(19-10-12-22(34-2)13-11-19)17-21-5-4-16-28-26(21)29-27/h4-13,16-17H,3,14-15H2,1-2H3,(H,32,33)(H,28,29,31)/b30-24+ |
| InChIKey | STDIHDWSDDXELK-BGABXYSRSA-N |
| XLogP | 5.55 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|